87-69-4 - Names and IdentifiersNameL(+)-Tartaric acidSynonymsFEMA 3044L-Tartaric AcidL+tartaric
E-postadress: info@standard-groups.com
| Name | L(+)-Tartaric acid |
| Synonyms | FEMA 3044 L-Tartaric Acid L+tartaric acid L(+)tartaric acid ACIDUM TARTARICUM L(+)-Tartaric acid L(-)-tartaric acid L(+)-Tartaric Acid L-(+)-Tartaric acid DEXTROTARTARIC ACID Natural tartaric acid DIHYDROXYSUCCINIC ACID L-Tartaric acid anhydrous (2R,3R)-(+)-TARTARIC ACID (2S,3S)-(-)-Tartaric acid L(+)-Tartaric Acid (FCCIV) L(+)-Tartaric Acid (BP2000) L(+)-Dihydroxysuccinic acid L(+)tartaric acid sigmaultra 2,3-DIHYDROXYDUTANEDIOIC ACID 2,3-DIHYDROXYBUTANEDIOIC ACID 2,2-dihydroxybutanedioic acid (2R,3R)-2,3-dihydroxybutanedioate (2R,3S)-2,3-dihydroxybutanedioate (2R,3R)-2,3-DIHYDROXYSUCCINIC ACID L(+)-2,3-dihydrooxy butanedioic acid L-1,2-Dihydroxyethan-1,2-dicarbonsaeure |
| CAS | 87-69-4 |
| EINECS | 201-766-0 |
| InChI | InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
| InChIKey | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| Molecular Formula | C4H6O6 |
| Molarmassa | 150.09 |
| Täthet | 1.76 |
| Melting Point | 170-172°C(lit.) |
| Boling Point | 191.59°C (rough estimate) |
| Specific Rotation(α) | 12 º (c=20, H2O) |
| Blixtpunkt | 210 °C |
| JECFA Number | 621 |
| Vattenlöslighet | 1390 g/L (20 ºC) |
| Solubility | Soluble in water, methanol, propanol, glycerin and ethanol, insoluble in chloroform. |
| Vapor Presure | <5 Pa (20 °C) |
| Vapor Density | 5.18 (vs air) |
| Utseende | White crystal |
| Färg | White or colorless |
| Merck | 14,9070 |
| BRN | 1725147 |
| pKa | 2.98, 4.34(at 25℃) |
| PH | 3.18(1 mM solution);2.55(10 mM solution);2.01(100 mM solution); |
| Lagringstillstånd | Store at +5°C to +30°C. |
| Stability | Stable. Incompatible with oxidizing agents, bases, reducing agents. Combustible. |
| Sensitive | Easily absorbing moisture |
| Refractive Index | 12.5 ° (C=5, H2O) |
| MDL | MFCD00064207 |
| Physical and Chemical Properties | Density 1.76 melting point 168-172°C flash point 210°C Specific Rotation 12 ° (c = 20, H2O) water-soluble 1390g/L (20°C) |
| Use | L( )-tartaric acid is widely used as a acidulant for beverages and other foods, for wine, soft drinks, sweets, bread, and certain gum-like sweets. Mainly used as acidulants, resolving agents and pharmaceutical raw materials |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| RTECS | WW7875000 |
| TSCA | Yes |
| HS Code | 29181200 |
| Hazard Note | Irritant |
| Raw Materials | Hydrogen peroxide |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
