97-67-6 - Names and IdentifiersNameL(-)-Malic acidSynonymspinguosuanL-MailcacidL-malic acidL(-)
E-postadress: info@standard-groups.com
| Name | L(-)-Malic acid |
| Synonyms | pinguosuan L-Mailcacid L-malic acid L(-)-Malic acid l-(ii)-malicacid L-(-)-Malic acid L-(-)-Malic acid, CP L-Hydroxysuccinic acid L-Gydroxybutanedioicacid (2S)-2-hydroxybutanedioate (S)-(-)-Hydroxysuccinic acid hydroxy-,(S)-Butanedioicacid Butanedioicacid,hydroxy-,(S)- (2S)-2-hydroxybutanedioic acid Butanedioic acid, 2-hydroxy-, (2S)- |
| CAS | 97-67-6 |
| EINECS | 202-601-5 |
| InChI | InChI=1/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChIKey | BJEPYKJPYRNKOW-REOHCLBHSA-N |
| Molecular Formula | C4H6O5 |
| Molarmassa | 134.09 |
| Täthet | 1.60 |
| Melting Point | 101-103 °C (lit.) |
| Boling Point | 167.16°C (rough estimate) |
| Specific Rotation(α) | -2 º (c=8.5, H2O) |
| Blixtpunkt | 220 °C |
| JECFA Number | 619 |
| Vattenlöslighet | soluble |
| Solubility | Soluble in water. 1g of the product can be dissolved in 1.4ml of alcohol, 1.7ml of ether, 0.7ml of methanol, 2.3ml of propanol, almost insoluble in benzene. |
| Vapor Presure | 0Pa at 25℃ |
| Utseende | Crystallization |
| Specific Gravity | 1.595 (20/4℃) |
| Färg | Vit |
| Merck | 14,5707 |
| BRN | 1723541 |
| pKa | (1) 3.46, (2) 5.10(at 25℃) |
| PH | 2.2 (10g/l, H2O, 20℃) |
| Lagringstillstånd | Store below +30°C. |
| Sensitive | Sensitive to light and easy to absorb moisture |
| Refractive Index | -6.5 ° (C=10, Aceton |
| MDL | MFCD00064213 |
| Physical and Chemical Properties | Melting point 101-103°C specific optical rotation -2 ° (c = 8.5, H2O) water-soluble solution |
| Use | Used as food additives, pharmaceutical raw materials |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | ON7175000 |
| TSCA | Yes |
| HS Code | 29181980 |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
