320-60-5 - Names and IdentifiersName2,4-Dichloro BenzotrifluorideSynonyms2,4-DCBTF2,4-Dichlorob
E-postadress: info@standard-groups.com
| Name | 2,4-Dichloro Benzotrifluoride |
| Synonyms | 2,4-DCBTF 2,4-Dichlorobenzotri 4-Dichlorobenzotrifluoride 2,4-dichlorobenzotrifluoride 2,4-dichloro-trifluoroMethyl 2,4-Dichloro Benzotrifluoride 2,4-dichloro-ααα-trifluorotoluene 1-(dichloromethyl)-2-fluorobenzene 2,4-dichloro-1-(trifluoromethyl)-benzen 2,4-dichloro-1-(trifluoromethyl)benzene Benzene, 2,4-dichloro-1-(trifluoromethyl)- 2,4-Dichloro-alpha,alpha,alpha-trifluorotoluene 2,4-Dichlorobenzotrifluoride,2,4-Dichloro-α,α,α-trifluorotoluene 1,3-Dichloro-4-(trifluoromethyl)benzene2,4-Dichloro-alpha,alpha,alpha-trifluorotoluene |
| CAS | 320-60-5 |
| EINECS | 206-278-1 |
| InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
| InChIKey | KALSHRGEFLVFHE-UHFFFAOYSA-N |
| Molecular Formula | C7H3Cl2F3 |
| Molarmassa | 215 |
| Täthet | 1.484 g/mL at 25 °C (lit.) |
| Melting Point | -26°C |
| Boling Point | 117-118 °C (lit.) |
| Blixtpunkt | 162°F |
| Vattenlöslighet | 8.67mg/L at 25℃ |
| Vapor Presure | 1.48hPa at 25℃ |
| Utseende | Liquid |
| Specific Gravity | 1.484 |
| Färg | Clear colorless |
| BRN | 2098743 |
| Lagringstillstånd | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.481(lit.) |
| Physical and Chemical Properties | Colorless liquid, specific gravity 1.484, boiling point 117-118 ℃, Flash Point 72 ℃, refractive index 1.4802, relative density 1.484. Insoluble in water, can be miscible with ethanol, ether. |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 2 |
| RTECS | CZ5566877 |
| TSCA | T |
| HS Code | 29039990 |
| Hazard Note | Corrosive |
| Hazard Class | 8 |
| Packing Group | III |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
