133-32-4 - Names and IdentifiersName3-Indolebutyric acidSynonymsIBASeradixjiffygrowNaftidrofury
E-postadress: info@standard-groups.com
| Name | 3-Indolebutyric acid |
| Synonyms | IBA Seradix jiffygrow Naftidrofuryl indolebutyricacid Indolebutyric acid hormexrootingpowder 3-Indolebutyvic acid 3-Indolebutyric acid indolyl-3-butyricacid Indole-3-butyric acid 3-Indole Butyric Acid 3-Indolylbutyric acid 1h-indole-3-butanoicacid Indole-3-butyric acid IBA 4-(3-Indolyl)butyric acid 4-(1H-indol-3-yl)butanoate kyselina4-indol-3-ylmaselina gamma-(3-indolyl)butyricacid gamma-(indole-3)-butyricacid 4-(3-1H-Indolyl)butyric acid gamma-(indol-3-yl)butyricacid 4-(1H-indol-3-yl)butanoic acid Indole-3-butyric acid,[4-(3-Indolyl)butyric acid] |
| CAS | 133-32-4 |
| EINECS | 205-101-5 |
| InChI | InChI=1/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15)/p-1 |
| InChIKey | JTEDVYBZBROSJT-UHFFFAOYSA-N |
| Molecular Formula | C12H13NO2 |
| Molarmassa | 203.24 |
| Täthet | 1.1255 (rough estimate) |
| Melting Point | 124-125.5°C(lit.) |
| Boling Point | 341.55°C (rough estimate) |
| Blixtpunkt | 211.8°C |
| Vattenlöslighet | Soluble in water(0.25g/L). |
| Solubility | Soluble in ethanol, ether and acetone, almost insoluble in water and chloroform. |
| Vapor Presure | 4.9E-08mmHg at 25°C |
| Utseende | White or light yellow crystals |
| Färg | Clear colorless to pale yellow |
| Merck | 14,4965 |
| BRN | 171120 |
| pKa | 4.83±0.10(Predicted) |
| Lagringstillstånd | 2–8°C |
| Stability | Stable. Incompatible with strong oxidizing agents. Light sensitive. |
| Sensitive | Air Sensitive |
| Refractive Index | 1.5440 (estimate) |
| MDL | MFCD00005664 |
| Physical and Chemical Properties | Melting point 120-125°C |
| Use | Used as plant growth stimulating hormone, promote plant root growth, improve germination rate, survival rate |
| Risk Codes | R25 - Toxic if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S38 - In case of insufficient ventilation, wear suitable respiratory equipment. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S28A - |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NL5250000 |
| FLUKA BRAND F CODES | 8-10-23 |
| TSCA | T |
| HS Code | 29339990 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
| Toxicity | LD50 i.p. in mice: 100 mg/kg (Anderson) |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
