87-51-4 - Names and IdentifiersName1H-Indole-3-acetic acidSynonymsIAAa-Iaa3-IAARhizopon AHetera
E-postadress: info@standard-groups.com
| Name | 1H-Indole-3-acetic acid |
| Synonyms | IAA a-Iaa 3-IAA Rhizopon A Heterauxin Heteroauxin Rhizopon A, AA indolyl-aceticaci 3-Indoleacetic acid Indole-3-acetic acid 1H-indol-3-ylacetate 3-Indole acetic acid 3-indolylacetic acid indol-3-ylacetic acid Acetic acid, indolyl- Indolyl-3-acetic acid Indolyl-3-acetic acid) IH-Indole-3-acetic acid kyselina3-indolyloctova 1H-Indole-3-acetic acid Kyselina 3-indolyloctova 3-Indoleacetic acid(IAA) Indole-3-acetic acid IAA omega-skatolecarboxylicacid omega-Skatole carboxylic acid Indole-3-acetic Acid (1.00353) Indole-3-acetic acid,(Heterauxin 2,3-dihydro-1H-indol-3-ylacetic acid |
| CAS | 87-51-4 |
| EINECS | 201-748-2 |
| InChI | InChI=1/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 |
| Molecular Formula | C10H9NO2 |
| Molarmassa | 175.18 |
| Täthet | 1.1999 (rough estimate) |
| Melting Point | 165-169 °C (lit.) |
| Boling Point | 306.47°C (rough estimate) |
| Blixtpunkt | 171°C |
| Vattenlöslighet | Soluble in ethanol (50 mg/ml), methanol, DMSO, and chloroform (sparingly). Insoluble in water. |
| Solubility | Soluble in acetone and ether, slightly soluble in chloroform, insoluble in water. |
| Vapor Presure | 1.24E-07mmHg at 25°C |
| Utseende | White crystalline powder |
| Färg | off-white to tan |
| Merck | 14,4964 |
| BRN | 143358 |
| pKa | 4.75(at 25℃) |
| Lagringstillstånd | -20°C |
| Stability | Stable. Incompatible with strong oxidizing agents. Light sensitive. |
| Sensitive | Light Sensitive |
| Refractive Index | 1.5460 (estimate) |
| MDL | MFCD00005636 |
| Physical and Chemical Properties | melting point 165-169°C |
| Use | Used as plant growth stimulating hormone and reagent |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | NL3150000 |
| FLUKA BRAND F CODES | 8-10-23 |
| TSCA | Yes |
| HS Code | 29339990 |
| Hazard Note | Irritant |
| Toxicity | LD50 intraperitoneal in mouse: 150mg/kg |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
