3483-12-3 - Names and IdentifiersNameDL-DithiothreitolSynonymsDTTTPTZL-DTTD-DttSputolysinDithit
E-postadress: info@standard-groups.com
| Name | DL-Dithiothreitol |
| Synonyms | DTT TPTZ L-DTT D-Dtt Sputolysin Dithithreitol Cleland regent Cleland reagent Clelands reagent DL-Dithothreitol DL-Dithiothreitol Cleland's reagent Clelands REDUCTACRYL D-1,4-Dithiothreitol (R,R)-Dithiothreitol 1,4-Dithio-l-threitol Threitol, 1,4-dithio- DL-1,4-Dithiothreitol 1,4-Dithio-DL-threitol 1,4-dithio-dl-threitol sol. DithiothreitollelandsReagenz threo-1,4-Dimercapto-2,3-butanediol 2,4,6-Tri(2-pyridyl)-1,3,5-triazine dithiothreitol (dtt) sequencing grade D-threo-1,4-Dimercapto-2,3-butanediol (R*,R*)-1,4-Dimercapto-2,3-butanediol (2S,3S)-1,4-disulfanylbutane-2,3-diol dithiothreitol molecular biology*reagent 2,3-Butanediol, 1,4-dimercapto-, D-threo- |
| CAS | 3483-12-3 27565-41-9 28823-08-7 28823-08-7 |
| EINECS | 248-531-9;222-468-7 |
| InChI | InChI=1/C4H10O2S2/c1-2(5)3(6)4(7)8/h2-8H,1H3 |
| Molecular Formula | C4H10O2S2 |
| Molarmassa | 154.251 |
| Melting Point | 42-44℃ |
| Boling Point | 125～130°C |
| Specific Rotation(α) | -0.2～+0.2°(20℃/D)(c=5,H2O) |
| Vattenlöslighet | Soluble |
| Solubility | Soluble in water, ethanol, acetone, ethyl acetate, chloroform and ether. |
| Utseende | White crystalline powder |
| Lagringstillstånd | 2-8℃ |
| Sensitive | Air and heat and humidity sensitivity |
| Refractive Index | 1.576 |
| MDL | MFCD00004877 |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
