Introduction1072-53-3 – Names and IdentifiersName1,3,2-dioxathiolane 2,2-dioxideSynonymsgl
E-postadress: info@standard-groups.com
| Name | 1,3,2-dioxathiolane 2,2-dioxide |
| Synonyms | glycolsulfate Ethylenesulfate 1,2-ETHYLENE SULFATE ethyleneglycol,cyclicsulfate 1,3,2-Dioxathiolane-2,2-Dioxide 1,3,2-dioxathiolane 2,2-dioxide 1,3,2-DIOXATHIOLANE 2,2-DIOXIDE 1,3,2-Dioxathiolane,2,2-dioxides 1,3,2-Dioxathiolan-2,2-oxide (DTD) |
| CAS | 1072-53-3 |
| EINECS | 600-809-4 |
| InChI | InChI=1/C2H4O4S/c3-7(4)5-1-2-6-7/h1-2H2 |
| InChIKey | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| Molecular Formula | C2H4O4S |
| Molarmassa | 124.12 |
| Täthet | 1.604±0.06 g/cm3 (20 ºC 760 Torr) |
| Melting Point | 95-97 °C (lit.) |
| Boling Point | 231.1±7.0℃ (760 Torr) |
| Blixtpunkt | 93.5±18.2℃ |
| Solubility | Chloroform, Methanol |
| Vapor Presure | 0.91-1.7Pa at 20-25℃ |
| Utseende | White to beige powder or crystal |
| Färg | White to Off-White |
| Lagringstillstånd | 2–8°C |
| Refractive Index | 1.5090 (estimate) |
| MDL | MFCD00221769 |
| Risk Codes | 22 – Harmful if swallowed |
| WGK Germany | 3 |
| RTECS | JH4800000 |
| HS Code | 29209085 |
| LogP | -0.45 at 23℃ and pH1.4-1.7 |
| surface tension | 66.8mN/m at 1g/L and 20 ℃ |
| Use | As an additive for the electrolyte of a lithium ion battery, the additive has the function of suppressing the decrease of the initial capacity of the battery, increasing the initial discharge capacity, reducing the expansion of the battery after being placed at a high temperature, and improving the charging and discharging performance and the number of cycles of the battery. Hydroxyethylating reagents for organic synthesis synthesize drug intermediates. It can also be used as a raw material for synthesizing certain heterocyclic compounds for gelatin hardening, antihypertensive drugs and new double surfactants |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
