3-Diethylaminopropylamine - Names and IdentifiersName3-DiethylaminopropylamineSynonymsDEAPAFENT
E-postadress: info@standard-groups.com
| Name | 3-Diethylaminopropylamine |
| Synonyms | DEAPA FENTAMINE DEAPA 3-Diethylaminopropyl DiethylaMino)propylaMin 3-dietgylpropanediamine 3-aminopropyldiethylamine 3-Diethylaminopropylamine (3-Diethylamino)propylamine 3-Diethylamino 1-propylamine Diethylaminotrimethylenamine N,N-(Diethylamino)propylamine 1-(Diethylamino)propylamine-3 1,1-diethyl-2-propylhydrazine N-(3-Diethylaminopropyl)amine N,N-Diethyl-1,3-Propyldiamine N,N-Diethyl-1,3-propanediamine N,N-Diethyl-1,3-diaminopropane N,N-Diethyl-1,3-propanediaMine 3-Propanediamine,N,N-diethyl-1 gamma-(Diethylamino)propylamine 1,3-Propanediamine,N,N-diethyl- N,N-Diethyl-1,3-propane diamine N,N-diethylpropane-1,3-diaminium 3-(N,N-Diethylamino)-1-propylamine 3-DIETHYLAMINO-1-PROPYLAMINE FOR SYNTHES 3-DiethylaminopropylamineN,N-Diethyl-1,3-propanediamine 3-(Diethylamino)propylamine,N,N-Diethyl-1,3-diaminopropane, N,N-Diethyl-1,3-propanediamine, DEAPA |
| CAS | 104-78-9 |
| EINECS | 203-236-4 |
| InChI | InChI=1/C7H18N2/c1-3-9(4-2)7-5-6-8/h3-8H2,1-2H3/p+2 |
| Molecular Formula | C7H18N2 |
| Molarmassa | 130.23 |
| Täthet | 0.826g/mLat 25°C(lit.) |
| Melting Point | -60 °C |
| Boling Point | 169-171°C(lit.) |
| Blixtpunkt | 138°F |
| Vattenlöslighet | MISCIBLE |
| Vapor Presure | 19.5 mm Hg ( 70 °C) |
| Vapor Density | 4.4 (vs air) |
| Utseende | Liquid |
| Specific Gravity | 0.827 (20/4℃) |
| Färg | Clear colorless to slightly yellow |
| BRN | 741879 |
| pKa | 10.32±0.25(Predicted) |
| PH | 11.7 (10g/l, H2O, 20℃) |
| Lagringstillstånd | Store below +30°C. |
| Sensitive | Air Sensitive |
| Explosive Limit | 1.0%(V) |
| Refractive Index | n20/D 1.442 |
| Physical and Chemical Properties | Density 0.82 melting point -60°C boiling point 168-171°C refractive index 1.4406-1.4426 flash point 53°C water-soluble MISCIBLE |
| Use | Mainly used as dyes, pigments, surfactants, pharmaceutical synthesis of intermediates |
| Risk Codes | R10 - Flammable R21/22 - Harmful in contact with skin and if swallowed. R34 - Causes burns R43 - May cause sensitization by skin contact |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2684 3/PG 3 |
| WGK Germany | 1 |
| RTECS | TX7350000 |
| TSCA | Yes |
| HS Code | 29212900 |
| Hazard Class | 3 |
| Packing Group | III |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
