Dibenzothiophene sulfone - Names and IdentifiersNameDibenzothiophene sulfoneSynonymsAKOS 114Dip
E-postadress: info@standard-groups.com
| Name | Dibenzothiophene sulfone |
| Synonyms | AKOS 114 Diphenylene sulfone Dibenzothiophene sulfone DIBENZOTHIOPHENE SULFONE Dibenzothiophene-5,5-dioxide DIBENZOTHIOPHENE-5,5-DIOXIDE Dibenzothiophene S,S-dioxide dibenzo[b,d]thiophene 5,5-dioxide Dibenzo[b,d]thiophene 5,5-dioxide Dibenzothiophene sulfoneDibenzothiophene dioxide |
| CAS | 1016-05-3 |
| EINECS | 213-805-9 |
| InChI | InChI=1/C12H8O2S/c13-15(14)11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H |
| Molecular Formula | C12H8O2S |
| Molarmassa | 216.26 |
| Täthet | 1.2983 (rough estimate) |
| Melting Point | 231-233 °C (lit.) |
| Boling Point | 326.68°C (rough estimate) |
| Blixtpunkt | 275.7°C |
| Vapor Presure | 6.03E-07mmHg at 25°C |
| Utseende | White powder or crystal |
| Färg | White to Almost white |
| Lagringstillstånd | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.5200 (estimate) |
| MDL | MFCD00004970 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29309090 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
