2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride - Names and IdentifiersName2,4-Dichloro-3-ethy
E-postadress: info@standard-groups.com
| Name | 2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride |
| Synonyms | 2,4-Dichloro-3-ethyl-6-aminophenolHCl 2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride 6-amino-2,4-dichloro-3-ethylphenol hydrochloride 2,4-dichloro-3-ethyl-6-aminophenol hydrochloride 6-amino-2,4-dichloro-3-ethyl-pheno hydrochloride 2-Amino-4, 6-dichloro-5-ethylphenol hydrochloride Phenol, 6-amino-2,4-dichlor-3-ethyl-, hydrochlorid Phenol, 6-amino-2,4-dichloro-3-ethyl-, hydrochloride |
| CAS | 101819-99-2 |
| InChI | InChI=1/C8H9Cl2NO.ClH/c1-2-4-5(9)3-6(11)8(12)7(4)10;/h3,12H,2,11H2,1H3;1H |
| Molecular Formula | C8H10Cl3NO |
| Molarmassa | 242.5301 |
| Boling Point | 338.2°C at 760 mmHg |
| Blixtpunkt | 158.3°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 5.08E-05mmHg at 25°C |
| Utseende | powder to crystal |
| Färg | Light yellow to Brown to Dark green |
| Lagringstillstånd | Room Temprature |
| Physical and Chemical Properties | Earth-yellow powder |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
