2-Amino-4-Methoxylpyridine - Names and IdentifiersName2-Amino-4-MethoxylpyridineSynonyms4-metho
E-postadress: info@standard-groups.com
| Name | 2-Amino-4-Methoxylpyridine |
| Synonyms | 4-methoxypyridin-2-amine 4-METHOXYPYRIDIN-2-AMINE 2-AMINO-4-METHOXYPYRIDINE 2-Amino-4-methoxypyridine 4-Methoxy-2-aMinopyridine 4-Methoxy-2-aminopyridine 2-Amino-4-methoxy pyridine 2-AMINO-4-METHOXYLPYRIDINE 2-Amino-4-Methoxylpyridine 4-METHOXY-PYRIDIN-2-YLAMINE 4-Methoxy-Pyridin-2-Ylamine 4-(Methyloxy)-2-pyridinaMine 4-Methoxy-Pyridine-2-ylamine |
| CAS | 10201-73-7 |
| EINECS | 202-713-4 |
| InChI | InChI=1/C6H8N2O/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3,(H2,7,8) |
| InChIKey | QPHBCOSULYSASF-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2O |
| Molarmassa | 124.14 |
| Täthet | 1.139±0.06 g/cm3(Predicted) |
| Melting Point | 120-121°C |
| Boling Point | 258.6±20.0 °C(Predicted) |
| Blixtpunkt | 110.2°C |
| Vattenlöslighet | Soluble in Dimethyl sulfoxide, methanol. Slightly soluble in water. |
| Solubility | DMSO, Methanol |
| Vapor Presure | 0.0136mmHg at 25°C |
| Utseende | Crystalline powder |
| Färg | Pale yellow |
| Maximum wavelength(λmax) | ['280nm(CHCl3)(lit.)'] |
| pKa | 7.79±0.11(Predicted) |
| Lagringstillstånd | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.56 |
| MDL | MFCD07437849 |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| introduction | 2-amino -4-methoxypyridine has a melting point of 120 to 121 degrees, a boiling point of 258.6±20.0 degrees (under one atmospheric pressure), a density of 1.1, and a yellow or yellow-white solid under normal temperature and pressure. It has good solubility in common organic solvents such as dimethyl sulfoxide, N,N-dimethylformamide, ethyl acetate and alcohol solvents, but it has poor solubility in water. |
| Användningar | 2-amino-4-methoxypyridine is a common organic synthesis intermediate. Its main purpose is to participate in chiral drug molecules as a molecular skeleton, Bioactive molecules and nitrogen-containing ligands in the synthesis. The amino group in its structure can connect the molecular skeleton to the target molecule through acylation reaction under appropriate conditions. In addition, it has been reported in the literature that under suitable reaction conditions, a halogen atom such as bromine and iodine can be introduced in the para position of the amino group. |
| Synthesis method | For the synthesis of 2-amino-4-methoxypyridine, the conventional synthesis method is based on its premise 2-bromo-4-methoxypyridine Starting from, under the promotion of appropriate copper salts, the coupling reaction with nitrogen atoms is carried out to obtain the target product. In addition, there is another synthetic route starting from 2-amino-4-chloro-pyridine. With the help of the electron-deficient nature of the pyridine ring, the target product can also be obtained through the aromatic nucleophilic substitution of sodium methoxide. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
