5-Ethylpyridine-2,3-dicarboxylic acid - Names and IdentifiersName5-Ethylpyridine-2,3-dicarboxyl
E-postadress: info@standard-groups.com
| Name | 5-Ethylpyridine-2,3-dicarboxylic acid |
| Synonyms | c-80185 5-ethylquinolinicacid Imazethapyr Impurity 9 5-Ethylquinolinic acid Imazethapyr intermediate 5-ethyl-3-pyridinedicarboxylicacid 5-ethyl-2,3-pyridinedicarboxylicacid 5-ethyl-2,3-pyridinedicarboxylic acid 5-ETHYLPYRIDINE-2,3-DICARBOXYLIC ACID 5-Ethylpyridine-2,3-dicarboxylic acid 2,3-Pyridinedicarboxylicacid, 5-ethyl- |
| CAS | 102268-15-5 |
| EINECS | 600-293-0 |
| InChI | InChI=1/C9H9NO4/c1-2-5-3-6(8(11)12)7(9(13)14)10-4-5/h3-4H,2H2,1H3,(H,11,12)(H,13,14) |
| Molecular Formula | C9H9NO4 |
| Molarmassa | 195.17 |
| Täthet | 1.388±0.06 g/cm3(Predicted) |
| Melting Point | 152-154°C |
| Boling Point | 421.2±45.0 °C(Predicted) |
| Blixtpunkt | 208.5°C |
| Solubility | Chloroform (Slightly, Heated, Sonicated), DMSO (Slightly, Sonicated), Methanol ( |
| Vapor Presure | 7.59E-08mmHg at 25°C |
| Utseende | White solid |
| Färg | White to Light yellow to Light orange |
| pKa | 5.47±0.20(Predicted) |
| Lagringstillstånd | -20°C Freezer, Under inert atmosphere |
| Refractive Index | 1.595 |
| MDL | MFCD00071733 |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37 - Wear suitable gloves. |
| UN IDs | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| RTECS | US8005000 |
| TSCA | Yes |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | 5-ethylpyridine-2, 3-dicarboxylic acid is used to synthesize a breathable microporous metal organic frame, which can Without losing the integrity of the frame, it shows the reversible contraction and expansion of pores. |
| Ansökan | 5-ethylpyridine-2, 3-dicarboxylic acid is a carboxylic acid derivative, which can be used as a pharmaceutical intermediate. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
