2,5-Pyridinedicarboxylic acid - Names and IdentifiersName2,5-Pyridinedicarboxylic acidSynonyms2
E-postadress: info@standard-groups.com
| Name | 2,5-Pyridinedicarboxylic acid |
| Synonyms | 2,5-LUTIDINIC ACID RARECHEM AL BO 2394 ISOCINCHOMERIC ACID Isocinchomeronic acid ISOCINCHOMERONIC ACID pyridine2,5-dicarboxylate 2,5-PYRIDINECARBOXYLIC ACID 2,5-Pyridinedicarboxylic acid 2,5-PYRIDINEDICARBOXYLIC ACID PYRIDINE-2,5-DICARBOXYLIC ACID Pyridine-2,5-dicarboxylic acid |
| CAS | 100-26-5 |
| EINECS | 202-834-2 |
| InChI | InChI=1/C7H5NO4/c9-6(10)4-1-2-5(7(11)12)8-3-4/h1-3H,(H,9,10)(H,11,12)/p-2 |
| InChIKey | LVPMIMZXDYBCDF-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO4 |
| Molarmassa | 167.12 |
| Täthet | 1.5216 (rough estimate) |
| Melting Point | 242-247°C (dec.)(lit.) |
| Boling Point | 295.67°C (rough estimate) |
| Blixtpunkt | 220.5°C |
| Vattenlöslighet | 1.237g/L(25 ºC) |
| Solubility | 1.2g/l |
| Vapor Presure | 1.48E-08mmHg at 25°C |
| Utseende | Yellow to yellow-green powder or lumpy |
| Färg | Yellow to green |
| Merck | 14,5159 |
| BRN | 131697 |
| pKa | 3.06±0.10(Predicted) |
| Lagringstillstånd | Inert atmosphere,2-8°C |
| Refractive Index | 1.6280 (estimate) |
| MDL | MFCD00006297 |
| Use | An intermediate for antiviral agents. |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Reference | 1. Cheng, Tao, et al. "Metabolism profiles of icariin in rats using ultra-high performance liquid chromatography coupled with quadrupole time-of-flight tandem mass spectrometry and in vitro enzymatic study." Journal of Chromatography B 1033 (2016): 353-360.ht |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| uses | intermediates in organic synthesis and pharmaceutical synthesis, intermediates in the manufacture of niacin, pesticides, dyes, etc. Can be used to synthesize Pfizer Sunepitron |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
