2,6-Dimethyl-Gamma-pyrone - Names and IdentifiersName2,6-Dimethyl-Gamma-pyroneSynonymsAURORA KA
E-postadress: info@standard-groups.com
| Name | 2,6-Dimethyl-Gamma-pyrone |
| Synonyms | AURORA KA-6632 2,6-DIMETHYL-G-PYRONE 2,6-DIMETHYL-4-PYRONE 2,6-Dimethyl-4-pyrone 2,6-Dimethyl-4-pyranone gamma-2,6-Dimethylpyrone 2,6-DIMETHYL-GAMMA-PYRONE 2,6-Dimethyl-gamma-pyrone 2,6-Dimethyl-Gamma-pyrone 2,6-dimethyl-4h-pyran-4-on 2,6-Dimethyl-4H-pyran-4-one 2,6-DIMETHYL-4H-PYRAN-4-ONE |
| CAS | 1004-36-0 |
| EINECS | 213-719-1 |
| InChI | InChI=1/C7H8O2/c1-5-3-7(8)4-6(2)9-5/h3-4H,1-2H3 |
| InChIKey | VSYFZULSKMFUJJ-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2 |
| Molarmassa | 124.14 |
| Täthet | 0.9953 |
| Melting Point | 133-137°C(lit.) |
| Boling Point | 248-250°C(lit.) |
| Blixtpunkt | 248-250°C |
| Vattenlöslighet | Slightly soluble in water. |
| Vapor Presure | 0.0235mmHg at 25°C |
| Utseende | White to light brown powder |
| Färg | White to beige |
| BRN | 107418 |
| Lagringstillstånd | Sealed in dry,Room Temperature |
| Refractive Index | 1.5300 (estimate) |
| MDL | MFCD00006579 |
| Hazard Symbols | Xn - Harmful |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 3 |
| RTECS | UQ0780000 |
| HS Code | 29329995 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
