4,6-Diamino-2-mercaptopyrimidine - Names and IdentifiersName4,6-Diamino-2-mercaptopyrimidineSyn
E-postadress: info@standard-groups.com
| Name | 4,6-Diamino-2-mercaptopyrimidine |
| Synonyms | AKOS USSH-4110073 6-AMINO-2-THIOCYTOSINE 4,6-Diamino-2-thiopyrimdine 4,6-Diamino-2-pyrimidinethiol 4,6-Diamino-2-mercaptopyrimidine 4,6-DIAMINO-2-MERCAPTOPYRIMIDINE 2-Mercapto-4,6-diaminopyrimidine 4,6-diamino-2(1h)-pyrimidinethion 4,6-diaminopyrimidine-2(1H)-thione 4,6-Diamino-2(1H)-pyrimidinethione 2(1h)-pyrimidinethione, 4,6-diamino- 2(1H)-Pyrimidinethione, 4,6-diamino- |
| CAS | 1004-39-3 |
| EINECS | 213-721-2 |
| InChI | InChI=1S/C4H6N4S/c5-2-1-3(6)8-4(9)7-2/h1H,(H5,5,6,7,8,9) |
| InChIKey | QCAWOHUJKPKOMD-UHFFFAOYSA-N |
| Molecular Formula | C4H6N4S |
| Molarmassa | 142.18 |
| Täthet | 1.78±0.1 g/cm3(Predicted) |
| Melting Point | >300°C(lit.) |
| Boling Point | 289.1±43.0 °C(Predicted) |
| Blixtpunkt | 128.7 °C |
| Solubility | 1 M NaOH: soluble2% |
| Utseende | Solid |
| Färg | Pale Beige to Light Brown |
| BRN | 124937 |
| pKa | 11.81±0.10(Predicted) |
| Lagringstillstånd | Store below +30°C. |
| Stability | Hygroscopic |
| MDL | MFCD00006078 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| RTECS | MB7660000 |
| HS Code | 2933 59 95 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
