1-methylnicotinamide chloride - Names and IdentifiersName1-methylnicotinamide chlorideSynonymsT
E-postadress: info@standard-groups.com
| Name | 1-methylnicotinamide chloride |
| Synonyms | TRIGONELLAMIDE CHLORIDE nicotinamidemethochloride nicotinamidemethylchloride NICOTINAMIDE CHLOROMETHYLATE 1-methylnicotinamide chloride N1-METHYLNICOTINAMIDE CHLORIDE 3-Carbamyl-1-methylpyridinium chloride 3-carbamoyl-1-methyl-pyridiniuchloride 3-carbamoyl-1-methylpyridinium chloride N-METHYLNICOTINIC ACID AMIDE CHLORIDE SALT 1-methylpyridine-3-carboxamide hydrochloride 3-(aminocarbonyl)-1-methyl-pyridiniuchloride |
| CAS | 1005-24-9 |
| EINECS | 463-670-7 |
| InChI | InChI=1/C7H9N2O.ClH/c1-9-4-2-3-6(5-9)7(8)10;/h2-5H,1H3,(H2,8,10);1H |
| Molecular Formula | C7H9ClN2O |
| Molarmassa | 172.61 |
| Melting Point | 207-209℃ (water acetone ) |
| Vattenlöslighet | almost transparency |
| Solubility | H2O: soluble15mg/mL, clear |
| Utseende | crystalline |
| Färg | white |
| Merck | 14,9693 |
| Lagringstillstånd | room temp |
| WGK Germany | 3 |
| RTECS | UU1925000 |
| biological activity | 1-Methylnicotinamide (1-MNA, 3-Carbamoyl-1-methylpyridin-1-ium, Trigonellamide) chloride is an active endogenous metabolite of nicotinamide, which has anti-inflammatory and anti-thrombotic effects. 1-Methylnicotinamide can enhance the formation of tumor blood vessels and significantly increase the production of prostacyclin (PGI2). |
| Target | Value |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
