5-Bromoindole - Names and IdentifiersName5-BromoindoleSynonyms5-BI5-Bromindole5-Bromoindole5-BR
E-postadress: info@standard-groups.com
| Name | 5-Bromoindole |
| Synonyms | 5-BI 5-Bromindole 5-Bromoindole 5-BROMOINDOLE 5-bromo indole 5-bromonindole 5-Bromide indole 5-Bromo-1H-indole 5-BROMO-1H-INDOLE |
| CAS | 10075-50-0 |
| EINECS | 233-208-7 |
| InChI | InChI=1/C8H6BrN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| InChIKey | VXWVFZFZYXOBTA-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrN |
| Molarmassa | 196.04 |
| Täthet | 1.5466 (rough estimate) |
| Melting Point | 90-92 °C (lit.) |
| Boling Point | 228.5°C (rough estimate) |
| Blixtpunkt | 145.5°C |
| Solubility | 126mg/l (calculated) |
| Vapor Presure | 0.000738mmHg at 25°C |
| Utseende | White-like crystal |
| Färg | White to light brown |
| BRN | 112877 |
| pKa | 16.04±0.30(Predicted) |
| Lagringstillstånd | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.6550 (estimate) |
| MDL | MFCD00005670 |
| Physical and Chemical Properties | trait-like white crystals |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29339990 |
| Hazard Note | Irritant |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
