2-Benzylpyridine - Names and IdentifiersName2-BenzylpyridineSynonyms2-Benzylpyridineα-Benzylpyr
E-postadress: info@standard-groups.com
| Name | 2-Benzylpyridine |
| Synonyms | 2-Benzylpyridine α-Benzylpyridine 2-benzyl-pyridin 2-BENZYLPYRIDINE AKOS BBS-00004383 Pyridine, 2-benzyl- 2-PHENYLPYRIDYLMETHANE PHENYL-2-PYRIDYLMETHANE 2-(PHENYLMETHYL)PYRIDINE 2-(Phenylmethyl)pyridine 2-(phenylmethyl)-pyridin |
| CAS | 101-82-6 |
| EINECS | 202-979-1 |
| InChI | InChI=1/C12H11N/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12/h1-9H,10H2 |
| InChIKey | PCFUWBOSXMKGIP-UHFFFAOYSA-N |
| Molecular Formula | C12H11N |
| Molarmassa | 169.22 |
| Täthet | 1.054 g/mL at 25 °C (lit.) |
| Melting Point | 8-10 °C (lit.) |
| Boling Point | 276 °C (lit.) |
| Blixtpunkt | 257°F |
| Vattenlöslighet | insoluble |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.00829mmHg at 25°C |
| Utseende | neat |
| Färg | yellow |
| BRN | 115875 |
| pKa | 5.13(at 25℃) |
| Lagringstillstånd | Store below +30°C. |
| Refractive Index | n20/D 1.579(lit.) |
| Physical and Chemical Properties | Density 1.054 melting point 8-10°C boiling point 276°C refractive index 1.577-1.58 flash point 125°C water-soluble insoluble |
| Use | For Organic synthesis |
| Risk Codes | R36 - Irritating to the eyes R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | 2810 |
| WGK Germany | 3 |
| RTECS | US2620000 |
| TSCA | Yes |
| HS Code | 29333999 |
| Toxicity | LD50 scu-mus: 1500 mg/kg AEPPAE 227,129,55 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | for organic synthesis |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | subcutaneous-mouse LD50: 1500 mg/kg |
| flammability hazard characteristics | open flame is flammable; combustion produces toxic sulfur oxide smoke; reaction with oxidant |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from oxidant |
| fire extinguishing agent | dry powder, foam, carbon dioxide, sand |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
