2,4,6-Trimethylbenzoyl has a wide range of uses.It can be used as an intermediate in organic synthes
E-postadress: info@standard-groups.com
Advantage of 2,4,6-Trimethylbenzoyl CAS No. 938-18-1 Non-toxic It is widely used Convenient storage
2,4,6-Trimethylbenzoyl has a wide range of uses.
It can be used as an intermediate in organic synthesis, as well as an additive for plastics and ink.
Produktnamn
2,4,6-Trimethylbenzoyl
Flera namn
2,4,6-Trimethylbenzoyl;
2,4,6-Trmethylbenzoyl Chloride;
Mesitoyl Chloride~Mesitylene-2-Carbonyl Chloride;
2,4,6-Trimethyl Benzoyl Chloride;
Mesitoyl Chloride
CAS No. 938-18-1
EC No. 213-339-6
MF No. C10H11ClO
MW No. 182.6467
| Name | 2,4,6-Trimethylbenzoyl chloride |
| Synonyms | TMBC MESITOYL CHLORIDE Mesitoyl chloride Mesitylcarbonylchloride 2,4,6-trmethylbenzoyl chloride 2,4,6-Trimethylbenzoyl cloride 2,4,6-Trimethylbenzoyl chloride 2,4,6-TRIMETHYLBENZOYL CHLORIDE 2,4,6-Trimethyl benzoyl chloride BENZOYL CHLORIDE, 2,4,6-TRIMETHYL- Mesitoyl chloride~Mesitylene-2-carbonyl chloride Benzoyl chloride, 2,4,6-trimethyl- (6CI,7CI,8CI,9CI) |
| CAS | 938-18-1 |
| EINECS | 213-339-6 |
| InChI | InChI=1/C10H11ClO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
| Molecular Formula | C10H11ClO |
| Molarmassa | 182.65 |
| Täthet | 1.095 g/mL at 25 °C |
| Boling Point | 143-146 °C (60 mmHg) |
| Blixtpunkt | 143-146°C/60mm |
| Vattenlöslighet | Reacts slowly with water. |
| Vapor Presure | 1.52Pa at 25℃ |
| Utseende | Liquid |
| Färg | Clear light yellow |
| BRN | 776108 |
| Lagringstillstånd | 2–8°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.528-1.53 |
| Physical and Chemical Properties | Colorless liquid. |
| Use | Used as an additive for plastics and inks |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
