Product Name 4-Aminobutyric Acid4-Multiple Names Aminobutyric Acid;Gaba;Gamma-Aminobutyric Acid;Pipe
E-postadress: info@standard-groups.com
It is used in biochemical research and medicine to treat various diseases caused by liver coma and cerebrovascular disorders. Advantage of 4-Aminobutyric Acid CAS No. 56-12-2 It has deliquescence, very soluble in water, slightly soluble in hot ethanol, insoluble in cold ethanol, ether and benzene It is widely used in chemical field.
| Name | 4-Aminobutyric acid |
| Synonyms | Gaba aurora ka-1053 AURORA KA-1053 piperidic acid piperidinic acid 4-AMINOBUTYRIC ACID 4-Aminobutyric acid γ-aminobutyric acid aminobutyric-4 acid AMINOBUTYRIC-4 ACID 4-amino butyric acid 4-AMINOBUTANOIC ACID 4-aminobutanoic acid h-4-aminobutyric acid AMINOBUTYRIC ACID, 4- H-4-AMINOBUTYRIC ACID aminobutyric acid, 4- 4-AMINO-N-BUTYRIC ACID 4-amino-n-butyric acid gamma-aminobutyric acid gamma aminobutyric acid ALPHA-AMINOBUTANOIC ACID gamma.-aminobutyric acid alpha-aminobutanoic acid |
| CAS | 56-12-2 |
| EINECS | 200-258-6 |
| InChI | InChI=1/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
| InChIKey | BTCSSZJGUNDROE-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO2 |
| Molarmassa | 103.12 |
| Täthet | 1.2300 (estimate) |
| Melting Point | 195 °C (dec.) (lit.) |
| Boling Point | 248.0±23.0 °C(Predicted) |
| Blixtpunkt | 103.8°C |
| JECFA Number | 1771 |
| Vattenlöslighet | SOLUBLE |
| Solubility | Easily soluble in water, slightly soluble in hot ethanol, insoluble in cold ethanol, ether and benzene |
| Vapor Presure | 0.00798mmHg at 25°C |
| Utseende | White crystal |
| Färg | White to almost white |
| Merck | 14,430 |
| BRN | 906818 |
| pKa | 4.031(at 25℃) |
| Lagringstillstånd | 2–8°C |
| Refractive Index | 1.4650 (estimate) |
| MDL | MFCD00008226 |
| Physical and Chemical Properties | Appearance: white or off-white crystalline powder, with slightly odor and slightly bitter taste. |
| Use | Can reduce blood ammonia, promote brain metabolism. For the treatment of various types of liver Coma, also used for brain stroke sequelae, cerebral arteriosclerosis, head trauma sequelae and uremia, gas poisoning caused by Coma. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
