Product Name4-Benzoylbiphenyl4-Multiple NamesBenzoylbiphenyl;(1,1-Biphenyl)-4-Yl)Phenylmethanone;5-P
E-postadress: info@standard-groups.com
UV-curable coatings and inks are important intermediates for the synthesis of bifonazole and photosensitizers for photosensitive resins. Intermediate of antifungal drug bifonazole. Advantage of 4-Benzoylbiphenyl CAS No. 2128-93-0 It is no harm It can prevent hydrogen peroxide from being damaged by catalysiser It is wided used and accept by market
| Name | 4-Benzoylbiphenyl |
| Synonyms | 4-Benzoylbiphenyl Photoinitiator-PBZ 4-Phenybenzophenone P-PHENYLBENZOPHENONE 4-Phenylbenzophenone 4-PHENYLBENZOPHENONE 4-Phenyl benzopehone 4-Phenyl Benzophenone LABOTEST-BB LT00159468 4-biphenylylphenylketone 4-Diphenyl phenyl ketone 4-Biphenylyl phenyl ketone biphenyl-4-yl(phenyl)methanone (1,1'-biphenyl)-4-ylphenyl-methanon [1,1'-biphenyl]-4-ylphenyl-methanon [1,1'-biphenyl]-4-ylphenyl-Methanone ((1,1-Biphenyl)-4-yl)phenylmethanone ((1,1'-Biphenyl)-4-yl)phenylmethanone 4-Benzoylbiphenyl[1,1'-biphenyl]-4-ylphenyl-Methanone |
| CAS | 2128-93-0 |
| EINECS | 218-345-2 |
| InChI | InChI=1/C19H14O/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14H |
| InChIKey | LYXOWKPVTCPORE-UHFFFAOYSA-N |
| Molecular Formula | C19H14O |
| Molarmassa | 258.31 |
| Täthet | 1.0651 (rough estimate) |
| Melting Point | 99-101°C(lit.) |
| Boling Point | 419-420°C(lit.) |
| Blixtpunkt | 184.3°C |
| Vattenlöslighet | 73.6μg/L at 20℃ |
| Solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Vapor Presure | 0Pa at 20℃ |
| Utseende | grayish crystalline powder |
| Färg | White to Off-White |
| BRN | 1876092 |
| Lagringstillstånd | Sealed in dry,Room Temperature |
| Refractive Index | 1.5500 (estimate) |
| MDL | MFCD00003079 |
| Physical and Chemical Properties | Melting point 99-103°C crystalline compound. |
| Use | Used as pharmaceutical intermediates and photoinitiator |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
