Product NameAmmonium CarbamateMultiple NamesAmmonium Aminoformate;Carbamic Acid, Ammonium Salt;Carba
E-postadress: info@standard-groups.com
It is a valuable ammoniating agent used in the production of fermentation promoters, electronic components, pharmaceuticals, pharmaceutical reagents, fermentation promoters, electronic components, etc. Analytical reagent and chemical reagent can be used as chromatographic analysis reagent and can be evolved into various carbonate products. Advantage of Ammonium Carbamate CAS No. 1111-78-0 Easy to store, stable product performance. It is widely used in the fermentation promoter product industry. It is widely used in the pharmaceutical intermediate industry.
| Name | Ammonium carbamate |
| Synonyms | HSDB 485 UNII-I2W9615SWP Ammonium carbamate AMMONIUM CARBAMATE Ammonium carbaminate ammoniumaminoformate Ammonium aminoformate AMMONIUM CARBAMATE R. G. CARBAMIC ACID AMMONIUM SALT Carbamic acid, ammonium salt Carbamicacid,monoammoniumsalt Carbamic acid, monoammonium salt ''Anhydride'' of ammonium carbonate |
| CAS | 1111-78-0 |
| EINECS | 214-185-2 |
| InChI | InChI=1/CH3NO2.H3N/c2-1(3)4;/h2H2,(H,3,4);1H3 |
| InChIKey | BVCZEBOGSOYJJT-UHFFFAOYSA-N |
| Molecular Formula | CH6N2O2 |
| Molarmassa | 78.07 |
| Täthet | 1,6 g/cm3 |
| Melting Point | 59-61°C (subl.) |
| Boling Point | 58.76°C (estimate) |
| Blixtpunkt | 105.6°C |
| Vattenlöslighet | Soluble in cold water and ammonium hydroxide. Slightly soluble in alcohol. Insoluble in acetone. |
| Solubility | 790g/l |
| Vapor Presure | 100 mm Hg ( 26.7 °C) |
| Utseende | Powder |
| Färg | Vit |
| Merck | 14,507 |
| BRN | 3914091 |
| PH | 10 (100g/l, H2O, 20℃) |
| Lagringstillstånd | 2–8°C |
| Stability | Stable, but may be moisture sensitive. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Explosive Limit | 2% |
| Refractive Index | 1.4616 (estimate) |
| Use | Used as aluminum phosphide intermediate, also used in medicine |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
