Product NameBenzilMultiple NamesBenzil;Dibenzoyl;Diphenylethanedione;Melting Point Standard Benzil;1
E-postadress: info@standard-groups.com
It is used as pharmaceutical intermediate, photosensitizer of UV curing resin, pharmaceutical raw material, organic synthesis intermediate, pesticide, photosensitizer, organic synthesis intermediate, adhesive, etc. Advantage of Benzil CAS No. 134-81-6 Soluble in ethanol, ether and other organic solvents It is optically active Stable, combustible, Incompatible with strong oxidizing agents.
| Name | Benzil |
| Synonyms | Benzil BENZIL BIBENZOYL Dibenzoyl AURORA 14062 DIPHENYLGLYOXAL DIPHENYL DIKETONE Diphenylethanedione DIPHENYL-A B-DIKETONE 1,2-DIPHENYLETHANEDIONE 1,2-diphenylethane-1,2-dione 1,2-DIPHENYL-1,2 ETHANEDIONE Melting point standard benzil |
| CAS | 134-81-6 |
| EINECS | 205-157-0 |
| InChI | InChI=1/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| Molecular Formula | C14H10O2 |
| Molarmassa | 210.23 |
| Täthet | 1,521 g/cm3 |
| Melting Point | 94-95°C(lit.) |
| Boling Point | 346 °C |
| Blixtpunkt | 346-348°C |
| Vattenlöslighet | 0.5 g/L (20 ºC) |
| Solubility | Soluble in alcohol, ether, chloroform, ethyl acetate, benzene, toluene and nitrobenzene, insoluble in water |
| Vapor Presure | 1 mm Hg ( 128.4 °C) |
| Utseende | Yellow crystal or powder |
| Färg | Vit |
| Merck | 14,1078 |
| BRN | 608047 |
| Lagringstillstånd | Store below +30°C. |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Sensitive | Sensitive to light |
| Refractive Index | 1.5681 (estimate) |
| MDL | MFCD00003080 |
| Physical and Chemical Properties | Yellow crystals. Optically active. Density 1.23. Melting point 95 °c. Boiling point 346-348 °c (decomposition). Soluble in ethanol and ether, insoluble in water. Benzoin is generated during reduction. |
| Use | Used as pharmaceutical intermediates, UV curing resin photosensitizer |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
