Chemical Name: FenclorimCAS No.:3740-92-9Assay: ≥99%Appearance:White crystalline powder
E-postadress: info@standard-groups.com
Fenclorim Usage: Used as a antidote agent for herbicides, to eliminate herbicide residues in the soil. Fenclorim Packaging and Shipping： 25KG/drum or as per buyer's requirements Fenclorim Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Name | Fenclorim |
| Synonyms | SOFIT femclorim NSC 27713 Fenclorim CGA-123407 fenclorime cga-123407 Fenclorime BRN 0142293 Fenclorim [ISO] fenclorim, fenclorime 4,6-dichloro-2-phenylpyrimidine 4,6-dichloro-2-phenyl-pyrimidin 4,6-DICHLORO-2-PHENYLPYRIMIDINE Pyrimidine, 4,6-dichloro-2-phenyl- 5-23-08-00007 (Beilstein Handbook Reference) |
| CAS | 3740-92-9 |
| InChI | InChI=1/C10H6Cl2N2/c11-8-6-9(12)14-10(13-8)7-4-2-1-3-5-7/h1-6H |
| Molecular Formula | C10H6Cl2N2 |
| Molarmassa | 225.07 |
| Täthet | 1.363±0.06 g/cm3(Predicted) |
| Melting Point | 92-93°C |
| Boling Point | 235.5±33.0 °C(Predicted) |
| Blixtpunkt | 118.9°C |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Sparingly) |
| Vapor Presure | 0.0762mmHg at 25°C |
| Utseende | neat |
| Färg | Off-White to Pale Yellow |
| BRN | 142293 |
| pKa | -4.69±0.30(Predicted) |
| Lagringstillstånd | Inert atmosphere,2-8°C |
| Refractive Index | 1.604 |
| Physical and Chemical Properties | Colorless crystals. Melting point of 96.9 ° C, the relative density of 1.5, soluble in acetone, cyclohexanone, dichloromethane, toluene, xylene, hexane-soluble, methanol, octanol, isopropanol. |
| Use | Safety herbicide |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
