Chemical Name: 3-(3-Hydroxyphenyl)propanoic AcidCAS No.:621-54-5Assay: ≥99%Appearance: White to off-
E-postadress: info@standard-groups.com
3-(3-Hydroxyphenyl)propanoic Acid Usage: Used as pharmaceutical intermediates. 3-(3-Hydroxyphenyl)propanoic Acid Packaging and Shipping： 25kg/drum or as per buyer's requirements 3-(3-Hydroxyphenyl)propanoic Acid Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Name | 3-(3-Hydroxyphenyl)propionic acid |
| Synonyms | IFLAB-BB F2119-0005 M-HYDROCOUMARIC ACID LABOTEST-BB LT00454600 3-Hydroxyhydrocinnamic acid 3-HYDROXYHYDROCINNAMIC ACID 3-(3-hydroxyl phenyl)propanol 3-hydroxy-benzenepropanoicaci 3-Hydroxyphenyl-propionic acid 3-(3-Hydroxyphenyl)propionic acid 3-(3-hydroxyphenyl)propanoic acid 3-(3-HYDROXYPHENYL)PROPIONIC ACID 3-(M-HYDROXYPHENYL)PROPIONIC ACID |
| CAS | 621-54-5 |
| EINECS | 210-692-8 |
| InChI | InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| Molecular Formula | C9H10O3 |
| Molarmassa | 166.17 |
| Täthet | 1.260 |
| Melting Point | 111 °C |
| Boling Point | 355℃ |
| Blixtpunkt | 182℃ |
| Solubility | Soluble in water, ethanol, ether |
| Vapor Presure | 1.23E-05mmHg at 25°C |
| Utseende | White-like to white crystals. |
| Färg | Pale Beige to Light Brown |
| BRN | 1947445 |
| pKa | 4.68±0.10(Predicted) |
| Lagringstillstånd | Sealed in dry,Room Temperature |
| Refractive Index | 1.58 |
| MDL | MFCD00016554 |
| Physical and Chemical Properties | Off-white to white crystals. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
