Chemical Name: 1,1-Cyclohexanediacetic acid mono amideCAS No.:99189-60-3Assay: ≥99%Appearance:white
E-postadress: info@standard-groups.com
1,1-Cyclohexanediacetic acid mono amide Usage： Used as pharmaceutical intermediate. 1,1-Cyclohexanediacetic acid mono amide Packaging and Shipping： 25kg/drum or as per buyer's requirements 1,1-Cyclohexanediacetic acid mono amide Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Name | 1,1-Cyclohexanediacetic acid mono amide |
| Synonyms | CAM CALM CAMI CALM1 DD132 CALML2 Calmodulin1, His tagged human 3,3-Pentamethyleneglutaramic acid 1,1-Cychexanediaceticacidmonoamide 1,1-Cyclohexanediacetic acid monoamide 1,1-CYCLOHESANEDIACETIS ACID MONOAMIDE 1,1-cyclohexane diacetic acid monoamide 1,1-Cyclohexanediacetic acid mono amide 1,1-Cyclohexane diacetic acid mono amide [1-(2-amino-2-oxoethyl)cyclohexyl]acetate [1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid |
| CAS | 99189-60-3 |
| EINECS | 449-430-4 |
| InChI | InChI=1/C10H17NO3/c11-8(12)6-10(7-9(13)14)4-2-1-3-5-10/h1-7H2,(H2,11,12)(H,13,14)/p-1 |
| Molecular Formula | C10H17NO3 |
| Molarmassa | 199.25 |
| Täthet | 1.135±0.06 g/cm3(Predicted) |
| Melting Point | 141-146 °C (lit.) |
| Boling Point | 443.6±18.0 °C(Predicted) |
| Blixtpunkt | 222.1°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 4.14E-09mmHg at 25°C |
| Utseende | White powder |
| Färg | White to Off-White |
| pKa | 4.72±0.10(Predicted) |
| Lagringstillstånd | Sealed in dry,Room Temperature |
| MDL | MFCD02181086 |
| Physical and Chemical Properties | Melting point 143-146°C |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
