Chemical Name:2-Chloro-4,5-difluorobenzoic acid CAS No.: 110877-64-0Assay: ≥99% Appearance:White to
E-postadress: info@standard-groups.com
2-Chloro-4,5-difluorobenzoic acid Usage： Used as pharmaceutical intermediate and other organic synthetic intermediates 2-Chloro-4,5-difluorobenzoic acid Packaging and Shipping： 25kg/ drum or as per buyer requirement. 2-Chloro-4,5-difluorobenzoic acid Storage: Ventilated and dry; separate from alkalis, oxidisers, organic materials and flammable materials
| Name | 2-Chloro-4,5-difluorobenzoic acid |
| Synonyms | 405-380-5 110877-64-0 QVR BG DF EF TIMTEC-BB SBB003616 RARECHEM AL BO 1000 2-chloro-4,5-difluorobenzoate 2-chloro-4,5-difluorophenyl acid 2-CHLORO-4,5-DIFLUOROBENZOIC ACID 2-Chloro-4,5-difluorobenzoic acid 2-Chloride-4,5-Difluoride Benzoic Acids |
| CAS | 110877-64-0 |
| EINECS | 405-380-5 |
| InChI | InChI=1/C7H3ClF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12)/p-1 |
| Molecular Formula | C7H3ClF2O2 |
| Molarmassa | 192.55 |
| Täthet | 1.4821 (estimate) |
| Melting Point | 103-106 °C (lit.) |
| Boling Point | 258 °C |
| Blixtpunkt | 257-259°C |
| Vattenlöslighet | 5.0 g/L (20 ºC) |
| Vapor Presure | 0.00273mmHg at 25°C |
| Utseende | White powder |
| Färg | Vit |
| BRN | 4247522 |
| pKa | 2.50±0.25(Predicted) |
| Lagringstillstånd | Sealed in dry,Room Temperature |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
