Chemical Name:2-Fluorophenol CAS No.: 367-12-4 Assay: ≥99%Appearance:Colorless to light brown trans
E-postadress: info@standard-groups.com
2-Fluorophenol Usage: Used as pharmaceutical intermediate and other organic synthetic intermediates 2-Fluorophenol Packaging and Shipping: 25kg/ drum or as per buyer requirement. 2-Fluorophenol Storage: Ventilated and dry; separate from alkalis, oxidisers, organic materials and flammable materials
Name | 2-Fluorophenol |
Synonyms | 2-Florophenol 2-fluoro-pheno 2-Fluorophenol 2-FLUOROPHENOL 2-Hydroxyfluorobenzene 2-FLUOROHYDROXYBENZENE Adjacent fluorine phenol 1-Fluoro-2-hydroxybenzene Fluorophenolmincolorlessliq |
CAS | 367-12-4 |
EINECS | 206-681-2 |
InChI | InChI=1/C6H5FO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
InChIKey | HFHFGHLXUCOHLN-UHFFFAOYSA-N |
Molecular Formula | C6H5FO |
Molarmassa | 112.1 |
Täthet | 1.256 g/mL at 25 °C (lit.) |
Melting Point | 16.1 °C (lit.) |
Boling Point | 171-172 °C/741 mmHg (lit.) |
Blixtpunkt | 116°F |
Vattenlöslighet | 80.72g/L(25 ºC) |
Solubility | 37.7g/l |
Vapor Presure | 2.86mmHg at 25°C |
Utseende | Transparent liquid |
Specific Gravity | 1.256 |
Färg | Clear colorless to light yellow-brownish |
BRN | 1905112 |
pKa | 8.73(at 25℃) |
Lagringstillstånd | Inert atmosphere,Room Temperature |
Stability | Stable. Flammable. Incompatible with strong oxidizing agents. |
Refractive Index | n20/D 1.511(lit.) |
MDL | MFCD00002155 |
Physical and Chemical Properties | Colorless transparent liquid, melting point 16.1 ℃, boiling point 171-172 ℃/741mmHg, Flash Point 46 ℃, specific gravity 1.256, refractive index 1.5140. |
Use | Used as pesticide, pharmaceutical and dye intermediates |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com