Chemical Name: Oleic acidCAS No.: 112-80-1Assay: ≥99.0%Appearance: Colorless to yellowish oily liqui
E-postadress: info@standard-groups.com
Oleic acid Usage： It is used to make soap, lubricant, flotation agent, ointment, oleate, etc. it is also a good solvent for fatty acids and oil soluble substances. Oleic acid Packaging and Shipping： 180KG/drum Oleic acid Storage: Stored in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Name | Oleic acid |
| Synonyms | red oil oleoate Metaupon Oleic acid Oleic acid, AR Metal polish,red OmniPur Oleic Acid 9Octadecenoicacid(9Z) Polishing compound,red 9-cis-Octadecenoicacid cis-9-Octadecenoic acid 9-Octadecenoic acid, cis- Oleic acid CETEARYL ALCOHOL Manufacturer |
| CAS | 112-80-1 |
| EINECS | 204-007-1 |
| InChI | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| InChIKey | ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
| Molecular Formula | C18H34O2 |
| Molarmassa | 282.46 |
| Täthet | 0.89 g/mL at 25 °C(lit.) |
| Melting Point | 13-14°C(lit.) |
| Boling Point | 360 °C |
| Blixtpunkt | 133°F |
| JECFA Number | 333 |
| Vattenlöslighet | negligible |
| Solubility | Insoluble in water, miscible in alcohol and ether, soluble in benzene and chloroform |
| Vapor Presure | 52 mm Hg ( 37 °C) |
| Vapor Density | 1.03 (vs air) |
| Utseende | oily |
| Specific Gravity | 0.892 (20/4℃) |
| Färg | Colorless to pale yellow |
| Odor | Peculiar Lard-Like |
| Merck | 14,6828 |
| BRN | 1726542 |
| pKa | pKa 5.35(H2O,t =25) (Uncertain) |
| Lagringstillstånd | -20°C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, aluminium. |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.377 |
| MDL | MFCD00064242 |
| Physical and Chemical Properties | density 0.89 |
| Use | For soap, lubricants, flotation agent, ointment and oleate, etc. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
