Chemical Name: 2,7-DihydroxynaphthaleneCAS No.: 582-17-2Assay: ≧98%Appearance: Gray-white powder
E-postadress: info@standard-groups.com
2,7-Dihydroxynaphthalene Usage： Used as dyes and pharmaceutical intermediates Raw material for the synthesis of sulfonic acid compounds and divinyl naphthalene compounds. 2,7-Dihydroxynaphthalene Packaging and Shipping： 25kg/drum or according to buyer require. 2,7-Dihydroxynaphthalene Storage: Stored in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Name | 2,7-Dihydroxynaphthalene |
| Synonyms | CI 76645 C.I. 76645 2,7-Naphthelendiol 2,7-Naphthalenediol naphthalene-2,7-diol 2,7-DIHYDROXYNAPTHALENE 2,7-Dihydroxynaphthalene 2,7-Dihydroxy Napthalene 2,7- twohydroxy naphthalene |
| CAS | 582-17-2 |
| EINECS | 209-478-7 |
| InChI | InChI=1/C10H8O2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6,11-12H |
| InChIKey | DFQICHCWIIJABH-UHFFFAOYSA-N |
| Molecular Formula | C10H8O2 |
| Molarmassa | 160.17 |
| Täthet | 1.0924 (rough estimate) |
| Melting Point | 185-190 °C (lit.) |
| Boling Point | 246.06°C (rough estimate) |
| Blixtpunkt | 193.5°C |
| Vattenlöslighet | insoluble |
| Solubility | Soluble in ethanol, ether and hot water, slightly soluble in benzene and chloroform, almost insoluble in light petroleum. |
| Vapor Presure | 3.62E-06mmHg at 25°C |
| Utseende | grayish white to gray powder |
| Färg | Gray |
| BRN | 2042383 |
| pKa | 9.14±0.40(Predicted) |
| Lagringstillstånd | Store below +30°C. |
| Refractive Index | 1.5418 (estimate) |
| MDL | MFCD00004085 |
| Physical and Chemical Properties | Melting point 184-189°C water-soluble insoluble |
| Use | Used as a dye, pharmaceutical intermediates |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
