Chemical Name:1,3-DifluorobenzeneCAS No.:372-18-9Assay: ≥99.0%Appearance:clear liquid
E-postadress: info@standard-groups.com
1,3-Difluorobenzene Usage： t is an important intermediate in the synthesis of fluorine medicine and pesticide 1,3-Difluorobenzene Packaging and Shipping： 25kg/ Drum or as required by buyer. 1,3-Difluorobenzene Storage: Store in a dry and ventilated warehouse; Stay away from the sun and humidity.
| Name | 1,3-Difluorobenzene |
| Synonyms | 1,3-DifL m-Difluorobenzene m-Difluro Benzene m-difluoro-benzen 1,3-Difluorobenzene 1,3-difluroethylene Benzene,m-difluoro- Benzene, m-difluoro- Difluoro-1,3-benzene benzene,1,3-difluoro- Between two fluorine benzene Aspartic acid beta-monoamide |
| CAS | 372-18-9 |
| EINECS | 206-746-5 |
| InChI | InChI=1/C6H4F2/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Formula | C6H4F2 |
| Molarmassa | 114.09 |
| Täthet | 1.163g/mLat 25°C(lit.) |
| Melting Point | -59 °C |
| Boling Point | 83 °C |
| Blixtpunkt | 36°F |
| Vattenlöslighet | insoluble |
| Solubility | 1.1g/l |
| Vapor Presure | 11.034-19.924kPa at 20-38.2℃ |
| Utseende | Liquid |
| Specific Gravity | 1.163 |
| Färg | Clear colorless to yellow |
| BRN | 1904537 |
| Lagringstillstånd | Flammables area |
| Refractive Index | n20/D 1.438(lit.) |
| Physical and Chemical Properties | Liquid. Melting Point -59 ℃, boiling point 83 ℃, flash point 2 ℃, relative density (18/4 ℃)1.155. |
| Use | It is an important intermediate for the synthesis of fluorine-containing medicines and pesticides |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
