Chemical Name: PregabalinCAS No.: 148553-50-8Assay: ≥99.0%Appearance: Off-white to white powder
E-postadress: info@standard-groups.com
Pregabalin CAS: 148553-50-8 Usage： Pregabalin is mainly used for the treatment of peripheral neuropathic pain and adjuvant treatment of localized partial seizures. Pregabalin CAS: 148553-50-8 Packaging and Shipping： 25kgs/Bag or Drum or as required by the buyer. Pregabalin CAS: 148553-50-8 Storage: Store in a cool, ventilated place, protect from sun, heat and moisture. Storage and transportation according to general chemical regulations.
| Name | pregabalin |
| Synonyms | CI 1008 CI-1008 PD 144723 Pregablin PD-144723 pregabalin PREGABALIN TOS-BB-0910 (R)-Pregabalin (S)-Pregabalin 3-isobutyl GABA Pregabalin [USAN] (R-)-3-isobutyl GABA Pregabalin intermediate PREDNISOLONESODIUMPHOSPHATE 3-(aminomethyl)-5-methyl-(S)-Lyrica 3-(aminomethyl)-5-methyl-hexanoic acid 3-(Aminomethyl)-5-methyl-hexanoic acid 3(S)-(AMINOMETHYL)-5-METHYLHEXANOIC ACID (3S)-3-(AMINOMETHYL)-5-METHYLHEXANOIC ACID (3R)-3-(aminomethyl)-5-methylhexanoic acid 3-(aminomethyl)-5-methyl-(3S)-Hexanoic acid (S)(+)-3-Aminomethyl-5-methyl-hecanoic acid (3S)-3-(aminomethyl)-5-methyl-hexanoic acid |
| CAS | 148553-50-8 |
| EINECS | 604-639-1 |
| InChI | InChI=1/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | AYXYPKUFHZROOJ-ZETCQYMHSA-N |
| Molecular Formula | C8H17NO2 |
| Molarmassa | 159.23 |
| Täthet | 0.997±0.06 g/cm3(Predicted) |
| Melting Point | 194-196°C |
| Boling Point | 274.0±23.0 °C(Predicted) |
| Specific Rotation(α) | D23 +10.52° (c = 1.06 in water) |
| Blixtpunkt | 9℃ |
| Solubility | deionized water: ≥10mg/mL |
| Vapor Presure | 0.00153mmHg at 25°C |
| Utseende | white powder |
| pKa | 4.23±0.10(Predicted) |
| Lagringstillstånd | 2–8°C |
| Refractive Index | 1.464 |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
