Chemical Name: DL-3-Hydroxybutyric acid sodium salt CAS No.: 150-83-4Assay: ≥ 99.0% Appearance: Whit
E-postadress: info@standard-groups.com
DL-3-Hydroxybutyric acid sodium salt Usage： Sodium 3-hydroxybutyrate can be directly used to produce aliphatic polyester plastics. It can also be combined with other compounds to produce plastics with excellent properties. DL-3-Hydroxybutyric acid sodium salt Packaging and Shipping： 25kg/ drum，25kg/bag or as per buyer requirement. DL-3-Hydroxybutyric acid sodium salt Storage： Store in a ventilated low-temperature dry warehouse;Store separately with oxidants, acids and alkali.
| Name | 3-hydroxybutyric acid, sodium salt |
| Synonyms | Sodium 3-hydroxyburyrate Sodium 3-hydroxybutyrate sodium 3-hydroxybutanoate B-HydroxybutyricAcidSodiumSalt 3-HYDROXYBUTYRIC ACID SODIUM SALT DL-B-HYDROXYBUTYRICACIDSODIUMSALT 3-Hydroxybutyric acid sodium salt 3-hydroxybutyric acid, sodium salt Dl-3-Hydroxybutyric Acid Sodium Salt dl-β-hydroxybutyric acid sodium salt DL-beta-Hydroxybutyric acid sodium salt Butanoic acid, 3-hydroxy-, monosodium salt DL-B-HYDROXYBUTYRIC ACID SODIUM*CRYSTALL INE |
| CAS | 150-83-4 |
| EINECS | 205-774-5 |
| InChI | InChI=1/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7) |
| InChIKey | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| Molecular Formula | C4H7NaO3 |
| Molarmassa | 126.09 |
| Melting Point | 167-170°C |
| Boling Point | 269.2°C at 760 mmHg |
| Blixtpunkt | 121°C |
| Solubility | Methanol (Slightly, Sonicated), Water (Slightly) |
| Vapor Presure | 0.000979mmHg at 25°C |
| Utseende | Kristallinskt pulver |
| Färg | Vit |
| BRN | 4824866 |
| Lagringstillstånd | 2–8°C |
| Stability | Hygroscopic |
| Sensitive | Hygroscopic |
| MDL | MFCD00016716 |
| In vitro study | 3-Hydroxybutyric acid sodium (β-Hydroxybutyric acid sodium) is capable of interacting with lipids (modeled using a DPPC monolayer) and altering phase behavior at clinical concentrations. 3-Hydroxybutyric acid sodium also diminishes the interfacial viscosity of DPPC Monolayers. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
