3,4-DIHYDROXYBENZOIC ACID mainly used as intermediate of dyestuff and medicine, as Analytical reagen
E-postadress: info@standard-groups.com
Package: 25KG/drum, or as buyer request. Storage: in a dry and ventilated warehouse; keep away from sunshine and moisture.
| Name | 3,4-Dihydroxybenzoic acid |
| Synonyms | AKOS 220-70 Hypogallic acid Protocatechuic aci RARECHEM AL BO 0347 Protocatechuic acid 3,4-dihydroxybenzoate Carbohydroquinonic acid 3,4-DIHYDROBENZOIC ACID 3,4-Dihydroxybenzoic acid 3,4-Dihydroxy benzoic acid CATECHOL-4-CARBOXYLIC ACID PROTOCATECHUIC ACID N-HYDRATE 3,4-Dihydroxybenzoic acid N-HYDRATE cyclohexa-1,5-diene-1-carboxylic acid Protocatechuic acid, 4-Carboxybenzene-1,2-diol, 4-Carboxycatechol |
| CAS | 99-50-3 |
| EINECS | 202-760-0 |
| InChI | InChI=1/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11)/p-1 |
| InChIKey | YQUVCSBJEUQKSH-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
| Molarmassa | 154.12 |
| Täthet | 1.54 |
| Melting Point | 197-200 °C (dec.) (lit.) |
| Boling Point | 237.46°C (rough estimate) |
| Blixtpunkt | 216.3°C |
| Vattenlöslighet | Soluble in hot alcohol and ether. Slightly soluble in water. |
| Solubility | Soluble in water, ethanol, ether, acetone, slightly soluble in benzene and chloroform, insoluble in petroleum ether. |
| Vapor Presure | 1.75E-07mmHg at 25°C |
| Utseende | White to brown crystalline powder, discolored in air |
| Färg | Beige to brown |
| Merck | 14,7894 |
| BRN | 1448841 |
| pKa | 4.48(at 25℃) |
| PH | 3.78(1 mM solution);3.25(10 mM solution);2.74(100 mM solution) |
| Lagringstillstånd | Store below +30°C. |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Sensitive | Air Sensitive |
| Refractive Index | 1.6400 (estimate) |
| MDL | MFCD00002509 |
| Physical and Chemical Properties | Melting Point: 198-202°C |
| Use | Used as a dye, pharmaceutical intermediates |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
