English name: 3-Aminobenzoic acid CAS NO.: 99-05-8 Molecular formula: C7H7NO2 Molecular weight: 137.
E-postadress: info@standard-groups.com
English name: 3-Aminobenzoic acid CAS NO.: 99-05-8 Molecular formula: C7H7NO2 Molecular weight: 137.14 Standard: enterprise standard Content: ≥99% Packaging: 5kg/bag
M-aminobenzoic acid is mainly used in the synthesis of pharmaceutical intermediates, white or light yellow crystals. M-aminobenzoic acid is soluble in acetone, soluble in boiling water, hot alcohol, hot chloroform and ether, slightly soluble in cold water, cold alcohol and cold chloroform, insoluble in benzene and gasoline, sweet, sublimation.
pharmaceutical and dye intermediates. Used in the manufacture of azo dyes, pharmaceutical ethyl iodide acid and bile acid, reagent.
used as photographic and pharmaceutical intermediates.
| Name | 3-Aminobenzoic acid |
| Synonyms | 3-Abz-OH 3-aminobenzoate 3-Aminobenzoic acid M-amino benzoic acid Aminobenzoic acid, 3- Between the aMino acid Mesalamine EP Impurity D Aminobenzenecarboxylic acid 3-AMINOBENZOIC ACID FOR SYNTHESIS |
| CAS | 99-05-8 |
| EINECS | 202-724-4 |
| InChI | InChI=1/C7H7NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H,9,10)/p-1 |
| Molecular Formula | C7H7NO2 |
| Molarmassa | 137.14 |
| Täthet | 1,51 g/cm3 |
| Melting Point | 178-180°C(lit.) |
| Boling Point | 251.96°C (rough estimate) |
| Blixtpunkt | 150°C |
| Vattenlöslighet | 5.9 g/L (15 ºC) |
| Solubility | Soluble in acetone, soluble in boiling water, hot ethanol, hot chloroform, slightly soluble in cold water, cold ethanol and cold chloroform, insoluble in benzene and gasoline. It's irritating. Solubility: 5.9g/l water (15°C) ,3g/100g ethanol, slightly soluble in ether |
| Vapor Presure | 1.41E-05mmHg at 25°C |
| Utseende | White crystal |
| Färg | White-brownish to beige-brown |
| Odor | Odorless |
| Merck | 14,421 |
| BRN | 471603 |
| pKa | 4.78(at 25℃) |
| Lagringstillstånd | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Sensitive to light |
| Refractive Index | 1.5323 (estimate) |
| MDL | MFCD00007795 |
| Physical and Chemical Properties | White or yellowish crystals. Melting point 174 ℃, relative density 1.5105(20/4 ℃). Soluble in acetone, soluble in boiling water, hot alcohol, hot chloroform and ether, slightly soluble in cold water, cold alcohol and cold chloroform, insoluble in benzene and gasoline. Sweet. Can sublimate. |
| Use | Used as photographic and pharmaceutical intermediates |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
