Name: Ethyl 2-(4-hydroxyphenyl)-4-methylthiazole-5-carboxylateCAS: 161797-99-5Appearance: yellowish
E-postadress: info@standard-groups.com
Synonyms: Ethyl 2-(4-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate Molecular Formula: C13H13NO3S Molecular Weight: 263.31 CAS Registry Number: 161797-99-5 Density: 1.274 Melting point: 180 ºC
Name: Ethyl 2-(4-hydroxyphenyl)-4-methylthiazole-5-carboxylate
CAS: 161797-99-5
Appearance: yellowish to white powder
Assay: ≥99%
Capacity: 100mt/year
Min.package: 1gram
Application: Febuxostat intermediate
Standard: enterprise export
| Name | Ethyl 2-(4-hydroxyphenyl)-4-methylthiazole-5-carboxylate |
| Synonyms | Intermediates of Febuxostat 2-(4-hydroxyphenyl)-4-methylthiazole-5-carboxylate ethyl 2-(4-hydroxyphenyl)-4-Methyl-5-Thiazolecarboxylate Ethyl 2-(4-hydroxyphenyl)-4-methylthiazole-5-carboxylate Ethyl-2-(4-Hydroxyphenyl)-4-Methyl-5-Thiazolecarboxylate Ethyl2-(4-hydroxy phenyl)-4-methylthiazole-5-carboxylate Ethyl 2-(4-HydroxyPhenyl)-4-Methyl Thiazole-5-Carboxylate ethyl 2-(4-hydroxyphenyl)-4-methyl thiazole-5-carboxylate Ethyl 2-(4-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate 2-(4-hydroxyphenyl)-4-Methyl-5-Thiazolecarboxylicacid ethyl ester 2-(4-Hydroxyphenyl)-4-methylthiazole-5-carboxytic acid ethyl ester 5-Thiazolecarboxylic acid, 2-(4-hydroxyphenyl)-4-Methyl-, ethyl ester Ethyl 2-(4-hydroxyphenyl)-4-methylthiazole-5-carboxylate Ethyl 2-(4-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| CAS | 161797-99-5 |
| EINECS | 605-268-8 |
| InChI | InChI=1/C13H13NO3S/c1-3-17-13(16)11-8(2)14-12(18-11)9-4-6-10(15)7-5-9/h4-7,15H,3H2,1-2H3 |
| Molecular Formula | C13H13NO3S |
| Molarmassa | 263.31 |
| Täthet | 1.274 |
| Melting Point | 180 ºC |
| Boling Point | 426.8±55.0 °C(Predicted) |
| Blixtpunkt | 211.933°C |
| Solubility | DMSO (Slightly), Methanol (Very Slightly) |
| Vapor Presure | 0mmHg at 25°C |
| Utseende | Solid |
| Färg | Off-White |
| pKa | 8.56±0.15(Predicted) |
| Lagringstillstånd | Sealed in dry,Room Temperature |
| Refractive Index | 1.598 |
| Physical and Chemical Properties | Appearance: light yellow crystals |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
