ItemSpecificationmelting point181-185 °Cpurity99%density1.1508MFC10H16O4boiling point297.96°C1,1-Cyc
E-postadress: info@standard-groups.com
| Item | Specifikation |
| melting point | 181-185 °C |
| purity | 99% |
| density | 1.1508 |
| MF | C10H16O4 |
| boiling point | 297.96°C |
1,1-Cyclohexanediacetic acid Usage： Used as pharmaceutical intermediate. 1,1-Cyclohexanediacetic acid Packaging and Shipping： 25kg/drum or as per buyer’s requirements 1,1-Cyclohexanediacetic acid Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Name | 1,1-Cyclohexanediacetic acid |
| Synonyms | CDA TIMTEC-BB SBB008597 Cyclohexyldiaceticacid Cyclohexyl diacetic acid Para Hydroxy benzoic acid 1,1-Cyanohexanediacetic acid 1,1-Cyclohexanediacetic acid 1,1-Cyclohexen diacetic acid 1,1-CYCLOHEXANE DIACETIC ACID Cyclohexane-1,1'-diacetic acid 1,1- CYCLOHEXANE DIACETIC ACID 3,3-Pentamethyleneglutaric Acid 1,1-Cyclohexanediacetic acid(CDA) 2,2'-cyclohexane-1,1-diyldiacetate 3-OXA-SPIRO[5.5]UNDECANE-2,4-DIONE 1,1-CYCLOHEXANE DIACETIC ACID (CDA) 2,2'-cyclohexane-1,2-diyldiacetic acid 2,2'-cyclohexane-1,1-diyldiacetic acid 1,1-Cyclohexanediaceticacid(ForGabapentin)(CDA) |
| CAS | 4355-11-7 |
| EINECS | 224-427-9 |
| InChI | InChI=1/C10H16O4/c11-8(12)6-10(7-9(13)14)4-2-1-3-5-10/h1-7H2,(H,11,12)(H,13,14)/p-2 |
| Molecular Formula | C10H16O4 |
| Molarmassa | 200.23 |
| Täthet | 1.1508 (rough estimate) |
| Melting Point | 181-185 °C (lit.) |
| Boling Point | 297.96°C (rough estimate) |
| Blixtpunkt | 213.3°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 1.02E-07mmHg at 25°C |
| Utseende | Solid |
| Färg | White to Off-White |
| pKa | pK1:3.49 ;pK2:6.96 (25°C) |
| Lagringstillstånd | Sealed in dry,Room Temperature |
| Refractive Index | 1.4459 (estimate) |
| MDL | MFCD00001519 |
| Physical and Chemical Properties | Melting point 181-185°C |
| Use | Used as a drug gabapentin Intermediate |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
