616-30-8 - Names and IdentifiersName3-Amino-1,2-propanediolSynonymsIsoserinol1-aminopropanediol
E-postadress: info@standard-groups.com
| Name | 3-Amino-1,2-propanediol |
| Synonyms | Isoserinol 1-aminopropanediol Glycerol α-monoamine Aminopropylene glycol 3-aminopropane-1,2-diol 1-amino-2,3-propanediol 3-Amino-1,2-propanediol 2,3-dihydroxypropylamine 3-Amino propane-1,2-diol 1-Amino-2,3-dihydroxypropane (2R)-2,3-dihydroxypropan-1-aminium 3-Amino-1,2-propanediol (Isoserinol) |
| CAS | 616-30-8 |
| EINECS | 210-475-8 |
| InChI | InChI=1/C3H9NO2/c4-1-3(6)2-5/h3,5-6H,1-2,4H2/p+1/t3-/m1/s1 |
| InChIKey | KQIGMPWTAHJUMN-UHFFFAOYSA-N |
| Molecular Formula | C3H9NO2 |
| Molarmassa | 91.11 |
| Täthet | 1.175g/mLat 25°C(lit.) |
| Melting Point | 55-57 °C |
| Boling Point | 264-265°C739mm Hg(lit.) |
| Blixtpunkt | >230°F |
| Vattenlöslighet | soluble |
| Solubility | >1000g/l soluble |
| Utseende | liquid (highly viscous) |
| Specific Gravity | 1.175 |
| Färg | Clear colorless to pale yellow |
| BRN | 1719121 |
| pKa | 12.11±0.35(Predicted) |
| PH | 11 (100g/l, H2O, 20℃) |
| Lagringstillstånd | Store below +30°C. |
| Sensitive | Hygroscopic |
| Refractive Index | n20/D 1.492(lit.) |
| Physical and Chemical Properties | |
| Use | Used as emulsifier, organic intermediate |
| Risk Codes | R34 - Causes burns R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36 - Wear suitable protective clothing. |
| UN IDs | UN 2735 8/PG 2 |
| WGK Germany | 2 |
| RTECS | TY2800000 |
| FLUKA BRAND F CODES | 10-21 |
| TSCA | Yes |
| HS Code | 29221980 |
| Hazard Note | Corrosive |
| Hazard Class | 8 |
| Packing Group | III |
| Toxicity | LD50 orally in Rabbit: 7500 mg/kg |
| Raw Materials | Ammonium hydroxide Epichlorohydrin |
| Användningar | Mainly used to produce X-CT nonionic contrast agent iohexol, synthetic special materials, and also used as pesticide intermediates It is a representative non-ionic contrast agent iohexol and important intermediates of iohexol, and it is also a pesticide intermediate. Used as emulsifier and organic intermediate |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 7500 mg/kg; Oral-mouse LD50: 2460 mg/kg |
| flammability hazard characteristics | combustible; combustion produces toxic nitrogen oxide smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
