2- octyldodecyl alcohol is used as an intermediate in medicine, organic and materials.Product Name2-
E-postadress: info@standard-groups.com
Advantage of 2-Octyl-1-Dodecanol CAS No. 5333-42-6 Good intermediate Wildly usage application
| Name | 2-octyl-1-dodecanol |
| Synonyms | NSC 2405 Exxal 20 Eutanol G Isofol 20 AI3-19966 JARCOL 1-20 icosan-9-ol BRN 1763479 Standamul G JARCOL I-20 Rilanit G 20 Octyldodecanol UNII-461N1O614Y Octyl dodecanol OCTYL DODECANOL 2-Octyldodecanol 2 OCTYL DODECANOL 2-Octyl dodecanol 2-octyl-1-dodecano 2-Octyldodecan-1-ol 2-OCTYL-1-DODECANOL 2-octyl-1-dodecanol 2-Octyl-1-dodecanol 2-octyldodecylalcohol ISO ARACHIDYL ALCOHOL 1-Dodecanol, 2-octyl- 2-Octyldodecyl alcohol 3-01-00-01844 (Beilstein Handbook Reference) |
| CAS | 5333-42-6 |
| EINECS | 226-242-9 |
| InChI | InChI=1/C20H42O/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2/h20-21H,3-19H2,1-2H3 |
| InChIKey | LEACJMVNYZDSKR-UHFFFAOYSA-N |
| Molecular Formula | C20H42O |
| Molarmassa | 298.55 |
| Täthet | 0.838g/mLat 25°C(lit.) |
| Melting Point | −1-1°C(lit.) |
| Boling Point | 234-238°C/33mmHg(lit.) |
| Blixtpunkt | 113°C |
| Vattenlöslighet | 10μg/L at 23℃ |
| Solubility | Practically insoluble in water, miscible with ethanol (96 per cent). |
| Vapor Presure | 0.1Pa at 148.85℃ |
| Utseende | neat |
| Färg | Colourless |
| pKa | 15.03±0.10(Predicted) |
| Lagringstillstånd | 2–8°C |
| Refractive Index | n20/D 1.453(lit.) |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
