A pesticide intermediate, toxic.It is only used for research and development, not for medicine, fami
E-postadress: info@standard-groups.com
Advantage of 2-Sec-Butylphenol CAS No. 89-72-5 Intermediate for synthesis of sec-butyl carb. Safe stock Widely used in reach field
| Name | 2-sec-Butylphenol |
| Synonyms | OSBP O-S-BUTYLPHENOL 2-SEC-BUTYLPHENOL O-SEC-BUTYLPHENOL 2-sec-Butylphenol 2-(butan-2-yl)phenol Phenol, o-sec-butyl- ORTHO-SEC-BUTYLPHENOL 1-(1-Methylpropyl)phenol Phenol,2-(1-methylpropyl)- phenol, 2-(1-methylpropyl)- 2-[(1R)-1-methylpropyl]phenol 2-[(1S)-1-methylpropyl]phenol |
| CAS | 89-72-5 |
| EINECS | 201-933-8 |
| InChI | InChI=1/C10H14O/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8,11H,3H2,1-2H3/t8-/m1/s1 |
| Molecular Formula | C10H14O |
| Molarmassa | 150.22 |
| Täthet | 0.982g/mLat 25°C(lit.) |
| Melting Point | 12°C(lit.) |
| Boling Point | 226-228°C(lit.) |
| Blixtpunkt | 234°F |
| Vattenlöslighet | Insoluble. <0.1 g/100 mL at 20 ºC |
| Vapor Presure | 0.03 mm Hg ( 20 °C) |
| Utseende | Liquid |
| Färg | White to Light yellow |
| Exponeringsgräns | ACGIH: TWA 5 ppm (Skin)NIOSH: TWA 5 ppm(30 mg/m3) |
| BRN | 1210026 |
| pKa | 10.36±0.35(Predicted) |
| Lagringstillstånd | Room Temprature |
| Stability | Stable, but air sensitive. Incompatible with acid chlorides, acid anhydrides, bases, strong oxidizing agents, copper and its alloys, brass. |
| Refractive Index | n20/D 1.522(lit.) |
| MDL | MFCD00002225 |
| Use | Used as an intermediate in the synthesis of SEC-dingwei |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
