white crystalline powder, mainly used in the pharmaceutical industry. Used in the synthesis of Chlor
E-postadress: info@standard-groups.com
package: 1KG/bag; 25KG/drum or according to clients' requirements. Storage: in a dry and ventilated warehouse; keep away from sunshine and moisture.
| Name | 3-Dimethylaminopropylchloride hydrochloride |
| Synonyms | 3-DMPC DMPC, HCl 3-Dimethylaminopropyl chloride HCL 3-Chloro-N,N-Dimethylpropylamine HCL 3-(DIMETHYLAMINO)-1-CHLORO-PROPANE HCL 3-chloro-N,N-dimethylpropan-1-aminium hcl 3-Dimethylaminopropylchloride hydrochloride 3-chloropropyldimethylammonium chloride hcl 3-DIMETHYLAMINOPROPYL CHLORIDE HYDROCHLORIDE 3-chloropropyldimethylammonium hydrochloride 3-Dimethylaminopropyl Chloride Hydrochloride 3-Dimethylaminorpopyl chloride hydrochloride 3-CHLORO-1-DIMETHYLAMINOPROPANE HYDROCHLORIDE 1-Chloro-3-dimethylaminopropane hydrochloride N-(3-chloropropyl)dimethylamine hydrochloride 3-Chloro-N,N-dimethylpropylamine hydrochloride N,N-DIMETHYL-3-CHLOROPROPYLAMINE hydrochloride 3-DIMETHYLAMINO-1-PROPYL CHLORIDE HYDROCHLORIDE N,N-DIMETHYLAMINO-3-CHLOROPROPANE HYDROCHLORIDE 1-(DIMETHYLAMINO)-3-CHLOROPROPANE HYDROCHLORIDE 3-Dimethylamino-1-propyl chloride hydrochloride N-(3-CHLOROPROPYL)-N,N-DIMETHYLAMMONIUM CHLORIDE 1-(N,N-DIMETHYLAMINO)-3-CHLORO PROPANE HYDROCHLORIDE 3-chloropropyldimethylammonium chloride hydrochloride |
| CAS | 1281-00-1 5407-04-5 |
| EINECS | 226-467-2 |
| InChI | InChI=1/C5H12ClN/c1-7(2)5-3-4-6/h3-5H2,1-2H3/p+1 |
| Molecular Formula | C5H13Cl2N |
| Molarmassa | 158.07 |
| Melting Point | 140-143°C(lit.) |
| Boling Point | 130.7°C at 760 mmHg |
| Blixtpunkt | 32.8°C |
| Vattenlöslighet | soluble |
| Vapor Presure | 9.61mmHg at 25°C |
| Utseende | Colorless crystal |
| Färg | White to yellow |
| Lagringstillstånd | Room Temprature |
| MDL | MFCD00012521 |
| Physical and Chemical Properties | Melting point 139-145°C water-soluble solution |
| Use | For the synthesis of chlorpromazine, doxepin hydrochloride, telden and other drugs |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
