White powder. Used as plating additives, biochemical reagents, analytical reagent of rhodium and pha
E-postadress: info@standard-groups.com
Package: 25KG/drum. Storage: in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Name | 4,6-Dihydroxy-2-mercaptopyrimidine |
| Synonyms | bathyran austranal Thiobarbituric Mealonylthiourea Thiobarbituicacid 2-Thiobarbituric acid 2-thiobarbituric acid minimum 2-Mercapto-4,6-dihydroxypyrimidine 4,6-Dihydroxy-2-mercaptopyrimidine 2-thioxodihydropyrimidine-4,6(1H,5H)-dione dihydro-2-thioxo-4,6(1h,5h)-pyrimidinedione 6(1H,5H)-Pyrimidinedione,dihydro-2-thioxo-4 Dihydro-2-thioxo-4,6-(1H,5H)-pyrimidinedione 6-hydroxy-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| CAS | 504-17-6 |
| EINECS | 207-985-8 |
| InChI | InChI=1/C4H4N2O2S/c7-2-1-3(8)6-4(9)5-2/h1H2,(H2,5,6,7,8,9) |
| InChIKey | RVBUGGBMJDPOST-UHFFFAOYSA-N |
| Molecular Formula | C4H4N2O2S |
| Molarmassa | 144.15 |
| Täthet | 1.451 (estimate) |
| Melting Point | 245°C (dec.)(lit.) |
| Vattenlöslighet | <6 g/L (20 ºC) |
| Solubility | Soluble in hot water, ethanol, ether, dilute alkali solution and dilute hydrochloric acid, slightly soluble in cold water |
| Utseende | White-like to yellow powder |
| Färg | Clear colorless |
| BRN | 120663 |
| pKa | 3.96±0.20(Predicted) |
| PH | 1.7-1.9 (10g/l, H2O, 20℃) |
| Lagringstillstånd | Inert atmosphere,2-8°C |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Sensitive | Sensitive to light and air |
| Refractive Index | 1.7690 (estimate) |
| MDL | MFCD00006674 |
| Physical and Chemical Properties | Colorless crystals. Melting point 235 °c (decomposition). Soluble in hot water, alcohol, ether, alkali and sodium carbonate solution, slightly soluble in water. |
| Use | This product is for scientific research only and shall not be used for other purposes. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
