Quinoline-6-carboxylic acid - Names and IdentifiersNameQuinoline-6-carboxylic acidSynonymsAKOS
E-postadress: info@standard-groups.com
| Name | Quinoline-6-carboxylic acid |
| Synonyms | AKOS BBS-00005339 TIMTEC-BB SBB003821 IFLAB-BB F0406-3604 Quinoline-6-Carboxylate 6-Quinolinecarboxylic Acid 6-QUINOLINECARBOXYLIC ACID Quinoline-6-Carboxylicacid Chinoline-6-Carboxylic Acid Quinoline-6-carboxylic acid Quinoline-6-carboxylic acid puriss 6-Carboxyquinoline, 6-Carboxy-1-azanaphthalene |
| CAS | 10349-57-2 |
| EINECS | 233-761-4 |
| InChI | InChI=1/C10H7NO2/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9/h1-6H,(H,12,13)/p-1 |
| Molecular Formula | C10H7NO2 |
| Molarmassa | 173.17 |
| Täthet | 1.2427 (rough estimate) |
| Melting Point | 293-294 °C |
| Boling Point | 303.81°C (rough estimate) |
| Blixtpunkt | 164.7°C |
| Vattenlöslighet | Practically insoluble in water |
| Vapor Presure | 1.85E-05mmHg at 25°C |
| Utseende | Crystalline powder |
| Färg | Beige to brown |
| pKa | 3.05±0.30(Predicted) |
| Lagringstillstånd | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5200 (estimate) |
| MDL | MFCD00047613 |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| TSCA | Yes |
| HS Code | 29334900 |
| Hazard Class | IRRITANT |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Ansökan | Quinolin-6-carboxylic acid is a quinoline organic substance and can be used as a pharmaceutical intermediate. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
