2,6-Dihydroxypyridine hydrochloride - Names and IdentifiersName2,6-Dihydroxypyridine hydrochlor
E-postadress: info@standard-groups.com
| Name | 2,6-Dihydroxypyridine hydrochloride |
| Synonyms | 2,6-PyridinediolHCl Pyridine-2,6-diolHCL 2,6-DIHYDROXYPYRIDINE HCL 6-hydroxypyridin-2(1H)-one 2,6-PYRIDINEDIOL HYDROCHLORIDE 2,6-Pyridinediol hydrochloride 6-hydroxy-2-oxopyridinium chloride 2,6-Dihydroxypyridine hydrochloride 2,6-DIHYDROXYPYRIDINE HYDROCHLORIDE 6-hydroxypyridin-2(1H)-one hydrochloride 6-Hydroxy-2-pyridone hydrochloride~2,6-Pyridinediol hydrochloride |
| CAS | 10357-84-3 |
| EINECS | 233-777-1 |
| InChI | InChI=1/C5H5NO2.ClH/c7-4-2-1-3-5(8)6-4;/h1-3H,(H2,6,7,8);1H |
| Molecular Formula | C5H6ClNO2 |
| Molarmassa | 147.56 |
| Melting Point | 206-208°C (dec.)(lit.) |
| Boling Point | 387.2°C at 760 mmHg |
| Blixtpunkt | 188°C |
| Vapor Presure | 1.35E-07mmHg at 25°C |
| Lagringstillstånd | Inert atmosphere,Room Temperature |
| MDL | MFCD00012817 |
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| introduction | 2,6-dihydroxypyridine hydrochloride is a chemical raw material that can be used in organic synthesis. |
| Ansökan | 2,6-dihydroxypyridine hydrochloride is a chemical raw material that can be used to prepare a pincer phosphine ligand iridium metal catalyst. The metal catalyst is highly responsive to carbon dioxide in the electrocatalytic reduction of carbon dioxide, and can effectively and selectively reduce carbon dioxide to formic acid, and the proportion of formic acid in all reduction products is extremely high. |
| biological activity | 6-Hydroxyyridin-2 (1H)-one hydrochloride is an endogenous metabolite. |
Ansvarsfriskrivning: Ovanstående innehåll är endast för referens och kommunikation mellan branschinsider, och garanterar inte dess riktighet eller fullständighet. Enligt gällande lagar och förordningar och förordningar på denna webbplats ska enheter eller individer som köper relaterade artiklar erhålla giltiga kvalifikationer och kvalifikationsvillkor.
Företagstelefon
+86-21-6420 0566
Arbetstider
måndag till fredag
Mobiltelefon:
13816217984
E-post:
info@qinsun-lab.com
